About benzene;naphthalen-1-yloxymethanol
benzene;naphthalen-1-yloxymethanol (PubChem CID 70447137) has the molecular formula C17H16O2
and a molecular weight of 252.31 g/mol. Its IUPAC name is benzene;naphthalen-1-yloxymethanol.
Molecular Properties
| Compound Name | benzene;naphthalen-1-yloxymethanol |
| PubChem CID | 70447137 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | benzene;naphthalen-1-yloxymethanol |
| SMILES | OCOc1cccc2ccccc12.c1ccccc1 |
| InChI | InChI=1S/C11H10O2.C6H6/c12-8-13-11-7-3-5-9-4-1-2-6-10(9)11;1-2-4-6-5-3-1/h1-7,12H,8H2;1-6H |
| InChIKey | YCLCMRKLRBSJQN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze benzene;naphthalen-1-yloxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;naphthalen-1-yloxymethanol?
The IUPAC name of benzene;naphthalen-1-yloxymethanol (CID 70447137) is benzene;naphthalen-1-yloxymethanol.
What is the SMILES notation for benzene;naphthalen-1-yloxymethanol?
The canonical SMILES for benzene;naphthalen-1-yloxymethanol is OCOc1cccc2ccccc12.c1ccccc1.
What is the InChIKey of benzene;naphthalen-1-yloxymethanol?
The InChIKey is YCLCMRKLRBSJQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2.C6H6/c12-8-13-11-7-3-5-9-4-1-2-6-10(9)11;1-2-4-6-5-3-1/h1-7,12H,8H2;1-6H.
What are the key properties of benzene;naphthalen-1-yloxymethanol?
benzene;naphthalen-1-yloxymethanol has a molecular weight of 252.31 g/mol, XLogP of 3.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;naphthalen-1-yloxymethanol is sourced from PubChem (CID 70447137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).