C17H20O4 — CID 21238595
but-3-en-2-one;3-naphthalen-1-yloxypropane-1,2-diol (PubChem CID 21238595) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is but-3-en-2-one;3-naphthalen-1-yloxypropane-1,2-diol.
| Compound Name | but-3-en-2-one;3-naphthalen-1-yloxypropane-1,2-diol |
|---|---|
| PubChem CID | 21238595 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | but-3-en-2-one;3-naphthalen-1-yloxypropane-1,2-diol |
| SMILES | C=CC(C)=O.OCC(O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C13H14O3.C4H6O/c14-8-11(15)9-16-13-7-3-5-10-4-1-2-6-12(10)13;1-3-4(2)5/h1-7,11,14-15H,8-9H2;3H,1H2,2H3 |
| InChIKey | RIHDISINANIKQC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|