C13H14O5 — CID 13130644
1-[7-(2,3-dihydroxypropoxy)-1-benzofuran-2-yl]ethanone (PubChem CID 13130644) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 1-[7-(2,3-dihydroxypropoxy)-1-benzofuran-2-yl]ethanone.
| Compound Name | 1-[7-(2,3-dihydroxypropoxy)-1-benzofuran-2-yl]ethanone |
|---|---|
| PubChem CID | 13130644 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1-[7-(2,3-dihydroxypropoxy)-1-benzofuran-2-yl]ethanone |
| SMILES | CC(=O)c1cc2cccc(OCC(O)CO)c2o1 |
| InChI | InChI=1S/C13H14O5/c1-8(15)12-5-9-3-2-4-11(13(9)18-12)17-7-10(16)6-14/h2-5,10,14,16H,6-7H2,1H3 |
| InChIKey | IPRYYNPKEKMUIX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |