C25H28N2O5 — CID 13455063
bis[7-[2-(dimethylamino)ethoxy]-1-benzofuran-2-yl]methanone (PubChem CID 13455063) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is bis[7-[2-(dimethylamino)ethoxy]-1-benzofuran-2-yl]methanone.
| Compound Name | bis[7-[2-(dimethylamino)ethoxy]-1-benzofuran-2-yl]methanone |
|---|---|
| PubChem CID | 13455063 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | bis[7-[2-(dimethylamino)ethoxy]-1-benzofuran-2-yl]methanone |
| SMILES | CN(C)CCOc1cccc2cc(C(=O)c3cc4cccc(OCCN(C)C)c4o3)oc12 |
| InChI | InChI=1S/C25H28N2O5/c1-26(2)11-13-29-19-9-5-7-17-15-21(31-24(17)19)23(28)22-16-18-8-6-10-20(25(18)32-22)30-14-12-27(3)4/h5-10,15-16H,11-14H2,1-4H3 |
| InChIKey | XHZRKGLPRHRZIM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |