C29H36N2O5 — CID 13393488
bis[7-[2-(diethylamino)ethoxy]-1-benzofuran-2-yl]methanone (PubChem CID 13393488) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is bis[7-[2-(diethylamino)ethoxy]-1-benzofuran-2-yl]methanone.
| Compound Name | bis[7-[2-(diethylamino)ethoxy]-1-benzofuran-2-yl]methanone |
|---|---|
| PubChem CID | 13393488 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | bis[7-[2-(diethylamino)ethoxy]-1-benzofuran-2-yl]methanone |
| SMILES | CCN(CC)CCOc1cccc2cc(C(=O)c3cc4cccc(OCCN(CC)CC)c4o3)oc12 |
| InChI | InChI=1S/C29H36N2O5/c1-5-30(6-2)15-17-33-23-13-9-11-21-19-25(35-28(21)23)27(32)26-20-22-12-10-14-24(29(22)36-26)34-18-16-31(7-3)8-4/h9-14,19-20H,5-8,15-18H2,1-4H3 |
| InChIKey | NCARYVOHBZTRGS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 68.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |