C19H27NO3 — CID 155698850
3-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]propanal;propane (PubChem CID 155698850) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]propanal;propane.
| Compound Name | 3-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]propanal;propane |
|---|---|
| PubChem CID | 155698850 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 3-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]propanal;propane |
| SMILES | CCC.O=CCCNCC(O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C16H19NO3.C3H8/c18-10-4-9-17-11-14(19)12-20-16-8-3-6-13-5-1-2-7-15(13)16;1-3-2/h1-3,5-8,10,14,17,19H,4,9,11-12H2;3H2,1-2H3 |
| InChIKey | OTRKXWPKPXESLG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|