C16H16F5NO2 — CID 10066392
1-naphthalen-1-yloxy-3-(2,2,3,3,3-pentafluoropropylamino)propan-2-ol (PubChem CID 10066392) has the molecular formula C16H16F5NO2 and a molecular weight of 349.30 g/mol. Its IUPAC name is 1-naphthalen-1-yloxy-3-(2,2,3,3,3-pentafluoropropylamino)propan-2-ol.
| Compound Name | 1-naphthalen-1-yloxy-3-(2,2,3,3,3-pentafluoropropylamino)propan-2-ol |
|---|---|
| PubChem CID | 10066392 |
| Molecular Formula | C16H16F5NO2 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-naphthalen-1-yloxy-3-(2,2,3,3,3-pentafluoropropylamino)propan-2-ol |
| SMILES | OC(CNCC(F)(F)C(F)(F)F)COc1cccc2ccccc12 |
| InChI | InChI=1S/C16H16F5NO2/c17-15(18,16(19,20)21)10-22-8-12(23)9-24-14-7-3-5-11-4-1-2-6-13(11)14/h1-7,12,22-23H,8-10H2 |
| InChIKey | REFPZANEXMRUED-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|