C21H30O2 — CID 2793899
1-naphthalen-1-yloxyundecan-2-ol (PubChem CID 2793899) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-naphthalen-1-yloxyundecan-2-ol.
| Compound Name | 1-naphthalen-1-yloxyundecan-2-ol |
|---|---|
| PubChem CID | 2793899 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-naphthalen-1-yloxyundecan-2-ol |
| SMILES | CCCCCCCCCC(O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C21H30O2/c1-2-3-4-5-6-7-8-14-19(22)17-23-21-16-11-13-18-12-9-10-15-20(18)21/h9-13,15-16,19,22H,2-8,14,17H2,1H3 |
| InChIKey | AVBJHCLWXHAOCT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|