C29H33NO4 — CID 162641225
1-[1,1,1,2,3,3,3-heptadeuteriopropan-2-yl-(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-3-naphthalen-1-yloxypropan-2-ol (PubChem CID 162641225) has the molecular formula C29H33NO4 and a molecular weight of 466.63 g/mol. Its IUPAC name is 1-[1,1,1,2,3,3,3-heptadeuteriopropan-2-yl-(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-3-naphthalen-1-yloxypropan-2-ol.
| Compound Name | 1-[1,1,1,2,3,3,3-heptadeuteriopropan-2-yl-(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-3-naphthalen-1-yloxypropan-2-ol |
|---|---|
| PubChem CID | 162641225 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 1-[1,1,1,2,3,3,3-heptadeuteriopropan-2-yl-(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-3-naphthalen-1-yloxypropan-2-ol |
| SMILES | [2H]C([2H])([2H])C([2H])(N(CC(O)COc1cccc2ccccc12)CC(O)COc1cccc2ccccc12)C([2H])([2H])[2H] |
| InChI | InChI=1S/C29H33NO4/c1-21(2)30(17-24(31)19-33-28-15-7-11-22-9-3-5-13-26(22)28)18-25(32)20-34-29-16-8-12-23-10-4-6-14-27(23)29/h3-16,21,24-25,31-32H,17-20H2,1-2H3/i1D3,2D3,21D |
| InChIKey | MKZHJJQCUIZEDE-PRCNHKIYSA-N |
| XLogP | 4.88 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |