C20H28N2O6 — CID 89013616
4-(dihydroxyamino)oxy-N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylbutanamide (PubChem CID 89013616) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxy-N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylbutanamide.
| Compound Name | 4-(dihydroxyamino)oxy-N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 89013616 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 4-(dihydroxyamino)oxy-N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylbutanamide |
| SMILES | CC(C)N(CC(O)COc1cccc2ccccc12)C(=O)CCCON(O)O |
| InChI | InChI=1S/C20H28N2O6/c1-15(2)21(20(24)11-6-12-28-22(25)26)13-17(23)14-27-19-10-5-8-16-7-3-4-9-18(16)19/h3-5,7-10,15,17,23,25-26H,6,11-14H2,1-2H3 |
| InChIKey | AFLRKIDUDYJTIR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|