C31H31NO4 — CID 18680042
9H-fluoren-9-ylmethyl N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylcarbamate (PubChem CID 18680042) has the molecular formula C31H31NO4 and a molecular weight of 481.59 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylcarbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 18680042 |
| Molecular Formula | C31H31NO4 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CC(O)COc1cccc2ccccc12)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H31NO4/c1-21(2)32(18-23(33)19-35-30-17-9-11-22-10-3-4-12-24(22)30)31(34)36-20-29-27-15-7-5-13-25(27)26-14-6-8-16-28(26)29/h3-17,21,23,29,33H,18-20H2,1-2H3 |
| InChIKey | MGFXJQWVCMXVNX-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |