C23H23N3O7 — CID 165341790
N-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-3,5-dinitro-N-propan-2-ylbenzamide (PubChem CID 165341790) has the molecular formula C23H23N3O7 and a molecular weight of 453.45 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-3,5-dinitro-N-propan-2-ylbenzamide.
| Compound Name | N-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-3,5-dinitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 165341790 |
| Molecular Formula | C23H23N3O7 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-3,5-dinitro-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(C[C@H](O)COc1cccc2ccccc12)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H23N3O7/c1-15(2)24(23(28)17-10-18(25(29)30)12-19(11-17)26(31)32)13-20(27)14-33-22-9-5-7-16-6-3-4-8-21(16)22/h3-12,15,20,27H,13-14H2,1-2H3/t20-/m0/s1 |
| InChIKey | DSTOMKICXKBNIR-FQEVSTJZSA-N |
| XLogP | 3.95 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|