C19H14N4O7 — CID 3267740
N'-(2-naphthalen-1-yloxyacetyl)-3,5-dinitrobenzohydrazide (PubChem CID 3267740) has the molecular formula C19H14N4O7 and a molecular weight of 410.34 g/mol. Its IUPAC name is N'-(2-naphthalen-1-yloxyacetyl)-3,5-dinitrobenzohydrazide.
| Compound Name | N'-(2-naphthalen-1-yloxyacetyl)-3,5-dinitrobenzohydrazide |
|---|---|
| PubChem CID | 3267740 |
| Molecular Formula | C19H14N4O7 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N'-(2-naphthalen-1-yloxyacetyl)-3,5-dinitrobenzohydrazide |
| SMILES | O=C(COc1cccc2ccccc12)NNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H14N4O7/c24-18(11-30-17-7-3-5-12-4-1-2-6-16(12)17)20-21-19(25)13-8-14(22(26)27)10-15(9-13)23(28)29/h1-10H,11H2,(H,20,24)(H,21,25) |
| InChIKey | PQWDBUUKVSPMGP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|