C15H12N4O7 — CID 59421966
N'-[2-(3-hydroxyphenyl)acetyl]-3,5-dinitrobenzohydrazide (PubChem CID 59421966) has the molecular formula C15H12N4O7 and a molecular weight of 360.28 g/mol. Its IUPAC name is N'-[2-(3-hydroxyphenyl)acetyl]-3,5-dinitrobenzohydrazide.
| Compound Name | N'-[2-(3-hydroxyphenyl)acetyl]-3,5-dinitrobenzohydrazide |
|---|---|
| PubChem CID | 59421966 |
| Molecular Formula | C15H12N4O7 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N'-[2-(3-hydroxyphenyl)acetyl]-3,5-dinitrobenzohydrazide |
| SMILES | O=C(Cc1cccc(O)c1)NNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12N4O7/c20-13-3-1-2-9(4-13)5-14(21)16-17-15(22)10-6-11(18(23)24)8-12(7-10)19(25)26/h1-4,6-8,20H,5H2,(H,16,21)(H,17,22) |
| InChIKey | HLEIFYVALXBUOV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|