C15H15N3O5 — CID 89245814
N-hydroxy-4-[[[2-(3-hydroxyphenyl)acetyl]amino]carbamoyl]benzeneamine oxide (PubChem CID 89245814) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is N-hydroxy-4-[[[2-(3-hydroxyphenyl)acetyl]amino]carbamoyl]benzeneamine oxide.
| Compound Name | N-hydroxy-4-[[[2-(3-hydroxyphenyl)acetyl]amino]carbamoyl]benzeneamine oxide |
|---|---|
| PubChem CID | 89245814 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-hydroxy-4-[[[2-(3-hydroxyphenyl)acetyl]amino]carbamoyl]benzeneamine oxide |
| SMILES | O=C(Cc1cccc(O)c1)NNC(=O)c1ccc([NH+]([O-])O)cc1 |
| InChI | InChI=1S/C15H15N3O5/c19-13-3-1-2-10(8-13)9-14(20)16-17-15(21)11-4-6-12(7-5-11)18(22)23/h1-8,18-19,22H,9H2,(H,16,20)(H,17,21) |
| InChIKey | CAVNVOMRDUMYEF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|