C16H13F3N2O4 — CID 59422031
4-hydroxy-N'-[2-(3-hydroxyphenyl)acetyl]-2-(trifluoromethyl)benzohydrazide (PubChem CID 59422031) has the molecular formula C16H13F3N2O4 and a molecular weight of 354.28 g/mol. Its IUPAC name is 4-hydroxy-N'-[2-(3-hydroxyphenyl)acetyl]-2-(trifluoromethyl)benzohydrazide.
| Compound Name | 4-hydroxy-N'-[2-(3-hydroxyphenyl)acetyl]-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 59422031 |
| Molecular Formula | C16H13F3N2O4 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 4-hydroxy-N'-[2-(3-hydroxyphenyl)acetyl]-2-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(Cc1cccc(O)c1)NNC(=O)c1ccc(O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H13F3N2O4/c17-16(18,19)13-8-11(23)4-5-12(13)15(25)21-20-14(24)7-9-2-1-3-10(22)6-9/h1-6,8,22-23H,7H2,(H,20,24)(H,21,25) |
| InChIKey | CGDVTDSCDSPZQI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|