C17H16N2O5 — CID 59421998
methyl 4-[[[2-(3-hydroxyphenyl)acetyl]amino]carbamoyl]benzoate (PubChem CID 59421998) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is methyl 4-[[[2-(3-hydroxyphenyl)acetyl]amino]carbamoyl]benzoate.
| Compound Name | methyl 4-[[[2-(3-hydroxyphenyl)acetyl]amino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 59421998 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl 4-[[[2-(3-hydroxyphenyl)acetyl]amino]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NNC(=O)Cc2cccc(O)c2)cc1 |
| InChI | InChI=1S/C17H16N2O5/c1-24-17(23)13-7-5-12(6-8-13)16(22)19-18-15(21)10-11-3-2-4-14(20)9-11/h2-9,20H,10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | ICKKOEVMJGMCMW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|