C15H13BrN2O3 — CID 17457296
N'-[2-(4-bromophenyl)acetyl]-3-hydroxybenzohydrazide (PubChem CID 17457296) has the molecular formula C15H13BrN2O3 and a molecular weight of 349.18 g/mol. Its IUPAC name is N'-[2-(4-bromophenyl)acetyl]-3-hydroxybenzohydrazide.
| Compound Name | N'-[2-(4-bromophenyl)acetyl]-3-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 17457296 |
| Molecular Formula | C15H13BrN2O3 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | N'-[2-(4-bromophenyl)acetyl]-3-hydroxybenzohydrazide |
| SMILES | O=C(Cc1ccc(Br)cc1)NNC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C15H13BrN2O3/c16-12-6-4-10(5-7-12)8-14(20)17-18-15(21)11-2-1-3-13(19)9-11/h1-7,9,19H,8H2,(H,17,20)(H,18,21) |
| InChIKey | PCWJLOQXAKOMHP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|