C21H17N3O5 — CID 5089126
3-nitro-N'-[2-(2-phenylphenoxy)acetyl]benzohydrazide (PubChem CID 5089126) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is 3-nitro-N'-[2-(2-phenylphenoxy)acetyl]benzohydrazide.
| Compound Name | 3-nitro-N'-[2-(2-phenylphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 5089126 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-nitro-N'-[2-(2-phenylphenoxy)acetyl]benzohydrazide |
| SMILES | O=C(COc1ccccc1-c1ccccc1)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17N3O5/c25-20(22-23-21(26)16-9-6-10-17(13-16)24(27)28)14-29-19-12-5-4-11-18(19)15-7-2-1-3-8-15/h1-13H,14H2,(H,22,25)(H,23,26) |
| InChIKey | OTUUVZOMWBZVHV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|