C26H27N3O5S — CID 55571075
N-cyclopentyl-3-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 55571075) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-cyclopentyl-3-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-cyclopentyl-3-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55571075 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-cyclopentyl-3-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | O=C(COc1ccccc1-c1ccccc1)NNC(=O)c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C26H27N3O5S/c30-25(18-34-24-16-7-6-15-23(24)19-9-2-1-3-10-19)27-28-26(31)20-11-8-14-22(17-20)35(32,33)29-21-12-4-5-13-21/h1-3,6-11,14-17,21,29H,4-5,12-13,18H2,(H,27,30)(H,28,31) |
| InChIKey | QIECXSFJAGKLEP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|