C15H20ClNO2 — CID 18529256
(1-hydroxy-2-naphthalen-1-yloxyethyl)-propan-2-ylazanium chloride (PubChem CID 18529256) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is (1-hydroxy-2-naphthalen-1-yloxyethyl)-propan-2-ylazanium chloride.
| Compound Name | (1-hydroxy-2-naphthalen-1-yloxyethyl)-propan-2-ylazanium chloride |
|---|---|
| PubChem CID | 18529256 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (1-hydroxy-2-naphthalen-1-yloxyethyl)-propan-2-ylazanium chloride |
| SMILES | CC(C)[NH2+]C(O)COc1cccc2ccccc12.[Cl-] |
| InChI | InChI=1S/C15H19NO2.ClH/c1-11(2)16-15(17)10-18-14-9-5-7-12-6-3-4-8-13(12)14;/h3-9,11,15-17H,10H2,1-2H3;1H |
| InChIKey | IUNNFKYPLSECJS-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|