C16H19NO3 — CID 6438998
2-hydroxy-3-naphthalen-1-yloxy-N-propan-2-ylpropan-1-imine oxide (PubChem CID 6438998) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-hydroxy-3-naphthalen-1-yloxy-N-propan-2-ylpropan-1-imine oxide.
| Compound Name | 2-hydroxy-3-naphthalen-1-yloxy-N-propan-2-ylpropan-1-imine oxide |
|---|---|
| PubChem CID | 6438998 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-hydroxy-3-naphthalen-1-yloxy-N-propan-2-ylpropan-1-imine oxide |
| SMILES | CC(C)/[N+]([O-])=C/C(O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C16H19NO3/c1-12(2)17(19)10-14(18)11-20-16-9-5-7-13-6-3-4-8-15(13)16/h3-10,12,14,18H,11H2,1-2H3/b17-10- |
| InChIKey | HZIWJRLPDPBUQJ-YVLHZVERSA-N |
| XLogP | 2.57 |
| TPSA | 55.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|