C16H22ClNO2 — CID 43834240
(2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylazanium chloride (PubChem CID 43834240) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is (2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylazanium chloride.
| Compound Name | (2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylazanium chloride |
|---|---|
| PubChem CID | 43834240 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylazanium chloride |
| SMILES | CC(C)[NH2+]CC(O)COc1cccc2ccccc12.[Cl-] |
| InChI | InChI=1S/C16H21NO2.ClH/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16;/h3-9,12,14,17-18H,10-11H2,1-2H3;1H |
| InChIKey | ZMRUPTIKESYGQW-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |