C32H52N2O5 — CID 173408797
N',3-dihydroxy-4-naphthalen-1-yloxybutanimidamide;octadecanoic acid (PubChem CID 173408797) has the molecular formula C32H52N2O5 and a molecular weight of 544.78 g/mol. Its IUPAC name is N',3-dihydroxy-4-naphthalen-1-yloxybutanimidamide;octadecanoic acid.
| Compound Name | N',3-dihydroxy-4-naphthalen-1-yloxybutanimidamide;octadecanoic acid |
|---|---|
| PubChem CID | 173408797 |
| Molecular Formula | C32H52N2O5 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.39 |
| IUPAC Name | N',3-dihydroxy-4-naphthalen-1-yloxybutanimidamide;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.NC(CC(O)COc1cccc2ccccc12)=NO |
| InChI | InChI=1S/C18H36O2.C14H16N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;15-14(16-18)8-11(17)9-19-13-7-3-5-10-4-1-2-6-12(10)13/h2-17H2,1H3,(H,19,20);1-7,11,17-18H,8-9H2,(H2,15,16) |
| InChIKey | XHICJNQWDQYRNU-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|