C23H38O2 — CID 155122599
1-[2-[(E)-prop-1-enyl]phenoxy]tetradecan-2-ol (PubChem CID 155122599) has the molecular formula C23H38O2 and a molecular weight of 346.55 g/mol. Its IUPAC name is 1-[2-[(E)-prop-1-enyl]phenoxy]tetradecan-2-ol.
| Compound Name | 1-[2-[(E)-prop-1-enyl]phenoxy]tetradecan-2-ol |
|---|---|
| PubChem CID | 155122599 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.55 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 1-[2-[(E)-prop-1-enyl]phenoxy]tetradecan-2-ol |
| SMILES | C/C=C/c1ccccc1OCC(O)CCCCCCCCCCCC |
| InChI | InChI=1S/C23H38O2/c1-3-5-6-7-8-9-10-11-12-13-18-22(24)20-25-23-19-15-14-17-21(23)16-4-2/h4,14-17,19,22,24H,3,5-13,18,20H2,1-2H3/b16-4+ |
| InChIKey | NHSWHOWAPVCYFF-AYSLTRBKSA-N |
| XLogP | 6.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|