C12H16O3 — CID 66896080
3-[2-[(Z)-prop-1-enyl]phenoxy]propane-1,2-diol (PubChem CID 66896080) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-[2-[(Z)-prop-1-enyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[2-[(Z)-prop-1-enyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 66896080 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-[2-[(Z)-prop-1-enyl]phenoxy]propane-1,2-diol |
| SMILES | C/C=C\c1ccccc1OCC(O)CO |
| InChI | InChI=1S/C12H16O3/c1-2-5-10-6-3-4-7-12(10)15-9-11(14)8-13/h2-7,11,13-14H,8-9H2,1H3/b5-2- |
| InChIKey | ZRXKVAGAQIRBMC-DJWKRKHSSA-N |
| XLogP | 1.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |