C20H26O8 — CID 24843324
3-[2-[2-[2-(2,3-dihydroxypropoxy)phenoxy]ethoxy]phenoxy]propane-1,2-diol (PubChem CID 24843324) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is 3-[2-[2-[2-(2,3-dihydroxypropoxy)phenoxy]ethoxy]phenoxy]propane-1,2-diol.
| Compound Name | 3-[2-[2-[2-(2,3-dihydroxypropoxy)phenoxy]ethoxy]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 24843324 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-[2-[2-[2-(2,3-dihydroxypropoxy)phenoxy]ethoxy]phenoxy]propane-1,2-diol |
| SMILES | OCC(O)COc1ccccc1OCCOc1ccccc1OCC(O)CO |
| InChI | InChI=1S/C20H26O8/c21-11-15(23)13-27-19-7-3-1-5-17(19)25-9-10-26-18-6-2-4-8-20(18)28-14-16(24)12-22/h1-8,15-16,21-24H,9-14H2 |
| InChIKey | JBKCNAIOCYYXIH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|