C13H21NO4 — CID 82850622
3-[2-[(2-methoxyethylamino)methyl]phenoxy]propane-1,2-diol (PubChem CID 82850622) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 3-[2-[(2-methoxyethylamino)methyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[2-[(2-methoxyethylamino)methyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 82850622 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 3-[2-[(2-methoxyethylamino)methyl]phenoxy]propane-1,2-diol |
| SMILES | COCCNCc1ccccc1OCC(O)CO |
| InChI | InChI=1S/C13H21NO4/c1-17-7-6-14-8-11-4-2-3-5-13(11)18-10-12(16)9-15/h2-5,12,14-16H,6-10H2,1H3 |
| InChIKey | YREYHYVDABNGLX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|