C14H22ClNO5 — CID 104665187
3-[4-chloro-2-methoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propane-1,2-diol (PubChem CID 104665187) has the molecular formula C14H22ClNO5 and a molecular weight of 319.79 g/mol. Its IUPAC name is 3-[4-chloro-2-methoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-chloro-2-methoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 104665187 |
| Molecular Formula | C14H22ClNO5 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-[4-chloro-2-methoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propane-1,2-diol |
| SMILES | COCCNCc1cc(Cl)cc(OC)c1OCC(O)CO |
| InChI | InChI=1S/C14H22ClNO5/c1-19-4-3-16-7-10-5-11(15)6-13(20-2)14(10)21-9-12(18)8-17/h5-6,12,16-18H,3-4,7-9H2,1-2H3 |
| InChIKey | PFTIAQVWSJTZNS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|