C25H26O3 — CID 70549561
3-[2-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]propane-1,2-diol (PubChem CID 70549561) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-[2-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[2-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 70549561 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 3-[2-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]propane-1,2-diol |
| SMILES | CC/C(=C(\c1ccccc1)c1ccccc1OCC(O)CO)c1ccccc1 |
| InChI | InChI=1S/C25H26O3/c1-2-22(19-11-5-3-6-12-19)25(20-13-7-4-8-14-20)23-15-9-10-16-24(23)28-18-21(27)17-26/h3-16,21,26-27H,2,17-18H2,1H3/b25-22- |
| InChIKey | CYPIWUCAYBYNNC-LVWGJNHUSA-N |
| XLogP | 4.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|