C13H17NO6 — CID 54086744
(3S)-3-amino-4-[2-(2,3-dihydroxypropoxy)phenyl]-4-oxobutanoic acid (PubChem CID 54086744) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is (3S)-3-amino-4-[2-(2,3-dihydroxypropoxy)phenyl]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[2-(2,3-dihydroxypropoxy)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54086744 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (3S)-3-amino-4-[2-(2,3-dihydroxypropoxy)phenyl]-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)c1ccccc1OCC(O)CO |
| InChI | InChI=1S/C13H17NO6/c14-10(5-12(17)18)13(19)9-3-1-2-4-11(9)20-7-8(16)6-15/h1-4,8,10,15-16H,5-7,14H2,(H,17,18)/t8?,10-/m0/s1 |
| InChIKey | MRAGZRNGCSQBHU-HTLJXXAVSA-N |
| XLogP | -0.60 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |