C38H34O8 — CID 142703345
bis[2-hydroxy-3-(2-phenylphenoxy)propyl] benzene-1,2-dicarboxylate (PubChem CID 142703345) has the molecular formula C38H34O8 and a molecular weight of 618.68 g/mol. Its IUPAC name is bis[2-hydroxy-3-(2-phenylphenoxy)propyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[2-hydroxy-3-(2-phenylphenoxy)propyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142703345 |
| Molecular Formula | C38H34O8 |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | bis[2-hydroxy-3-(2-phenylphenoxy)propyl] benzene-1,2-dicarboxylate |
| SMILES | O=C(OCC(O)COc1ccccc1-c1ccccc1)c1ccccc1C(=O)OCC(O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C38H34O8/c39-29(23-43-35-21-11-9-17-31(35)27-13-3-1-4-14-27)25-45-37(41)33-19-7-8-20-34(33)38(42)46-26-30(40)24-44-36-22-12-10-18-32(36)28-15-5-2-6-16-28/h1-22,29-30,39-40H,23-26H2 |
| InChIKey | YLXLEDCMDOFPOA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |