C18H18O4 — CID 118471959
3-(hydroxymethyl)-2-methylidene-4-(2-phenylphenoxy)butanoic acid (PubChem CID 118471959) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2-methylidene-4-(2-phenylphenoxy)butanoic acid.
| Compound Name | 3-(hydroxymethyl)-2-methylidene-4-(2-phenylphenoxy)butanoic acid |
|---|---|
| PubChem CID | 118471959 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-(hydroxymethyl)-2-methylidene-4-(2-phenylphenoxy)butanoic acid |
| SMILES | C=C(C(=O)O)C(CO)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C18H18O4/c1-13(18(20)21)15(11-19)12-22-17-10-6-5-9-16(17)14-7-3-2-4-8-14/h2-10,15,19H,1,11-12H2,(H,20,21) |
| InChIKey | PTLUNFVKYQKRJG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|