(3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid

C7H13NO6 — CID 54121468

IUPAC(3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid
SMILESN[C@@H](CC(=O)O)C(=O)OCC(O)CO
InChIInChI=1S/C7H13NO6/c8-5(1-6(11)12)7(13)14-3-4(10)2-9/h4-5,9-10H,1-3,8H2,(H,11,12)/t4?,5-/m0/s1
InChIKeyNNZDSYKHPTXFAZ-AKGZTFGVSA-N
MW207.18 g/mol
LogP-2.32
Rot. Bonds6

About (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid

(3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid (PubChem CID 54121468) has the molecular formula C7H13NO6 and a molecular weight of 207.18 g/mol. Its IUPAC name is (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid.

Molecular Properties

Compound Name(3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid
PubChem CID54121468
Molecular FormulaC7H13NO6
Molecular Weight207.18 g/mol
Exact Mass207.07
IUPAC Name(3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid
SMILESN[C@@H](CC(=O)O)C(=O)OCC(O)CO
InChIInChI=1S/C7H13NO6/c8-5(1-6(11)12)7(13)14-3-4(10)2-9/h4-5,9-10H,1-3,8H2,(H,11,12)/t4?,5-/m0/s1
InChIKeyNNZDSYKHPTXFAZ-AKGZTFGVSA-N
XLogP-2.32
TPSA130.08 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.18
LogP ≤ 5-2.32
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Analyze (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid?
The IUPAC name of (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid (CID 54121468) is (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid.
What is the SMILES notation for (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid?
The canonical SMILES for (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid is N[C@@H](CC(=O)O)C(=O)OCC(O)CO.
What is the InChIKey of (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid?
The InChIKey is NNZDSYKHPTXFAZ-AKGZTFGVSA-N. The full InChI is InChI=1S/C7H13NO6/c8-5(1-6(11)12)7(13)14-3-4(10)2-9/h4-5,9-10H,1-3,8H2,(H,11,12)/t4?,5-/m0/s1.
What are the key properties of (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid?
(3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid has a molecular weight of 207.18 g/mol, XLogP of -2.32, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid is sourced from PubChem (CID 54121468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).