C7H13NO6 — CID 54121468
(3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid (PubChem CID 54121468) has the molecular formula C7H13NO6 and a molecular weight of 207.18 g/mol. Its IUPAC name is (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54121468 |
| Molecular Formula | C7H13NO6 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (3S)-3-amino-4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)OCC(O)CO |
| InChI | InChI=1S/C7H13NO6/c8-5(1-6(11)12)7(13)14-3-4(10)2-9/h4-5,9-10H,1-3,8H2,(H,11,12)/t4?,5-/m0/s1 |
| InChIKey | NNZDSYKHPTXFAZ-AKGZTFGVSA-N |
| XLogP | -2.32 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |