C8H15NO6 — CID 135319453
4-amino-5-(2,3-dihydroxypropoxy)-5-oxopentanoic acid (PubChem CID 135319453) has the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. Its IUPAC name is 4-amino-5-(2,3-dihydroxypropoxy)-5-oxopentanoic acid.
| Compound Name | 4-amino-5-(2,3-dihydroxypropoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 135319453 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-amino-5-(2,3-dihydroxypropoxy)-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)OCC(O)CO |
| InChI | InChI=1S/C8H15NO6/c9-6(1-2-7(12)13)8(14)15-4-5(11)3-10/h5-6,10-11H,1-4,9H2,(H,12,13) |
| InChIKey | NKLMNPBHRGYRLU-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |