C10H17NO7 — CID 11129133
(4S)-4-acetamido-5-(2,3-dihydroxypropoxy)-5-oxopentanoic acid (PubChem CID 11129133) has the molecular formula C10H17NO7 and a molecular weight of 263.25 g/mol. Its IUPAC name is (4S)-4-acetamido-5-(2,3-dihydroxypropoxy)-5-oxopentanoic acid.
| Compound Name | (4S)-4-acetamido-5-(2,3-dihydroxypropoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11129133 |
| Molecular Formula | C10H17NO7 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (4S)-4-acetamido-5-(2,3-dihydroxypropoxy)-5-oxopentanoic acid |
| SMILES | CC(=O)N[C@@H](CCC(=O)O)C(=O)OCC(O)CO |
| InChI | InChI=1S/C10H17NO7/c1-6(13)11-8(2-3-9(15)16)10(17)18-5-7(14)4-12/h7-8,12,14H,2-5H2,1H3,(H,11,13)(H,15,16)/t7?,8-/m0/s1 |
| InChIKey | CNDLPZWIFQOEND-MQWKRIRWSA-N |
| XLogP | -1.75 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |