C7H15N3O4 — CID 139681719
(3S)-3-amino-4-(3,3-diaminopropoxy)-4-oxobutanoic acid (PubChem CID 139681719) has the molecular formula C7H15N3O4 and a molecular weight of 205.21 g/mol. Its IUPAC name is (3S)-3-amino-4-(3,3-diaminopropoxy)-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-(3,3-diaminopropoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139681719 |
| Molecular Formula | C7H15N3O4 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3S)-3-amino-4-(3,3-diaminopropoxy)-4-oxobutanoic acid |
| SMILES | NC(N)CCOC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C7H15N3O4/c8-4(3-6(11)12)7(13)14-2-1-5(9)10/h4-5H,1-3,8-10H2,(H,11,12)/t4-/m0/s1 |
| InChIKey | OWLGEISRGIIDTK-BYPYZUCNSA-N |
| XLogP | -2.03 |
| TPSA | 141.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|