C8H16N2O8 — CID 89081234
3-amino-4-[2-[2-(dihydroxyamino)oxyethoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 89081234) has the molecular formula C8H16N2O8 and a molecular weight of 268.22 g/mol. Its IUPAC name is 3-amino-4-[2-[2-(dihydroxyamino)oxyethoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[2-[2-(dihydroxyamino)oxyethoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89081234 |
| Molecular Formula | C8H16N2O8 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-amino-4-[2-[2-(dihydroxyamino)oxyethoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)OCCOCCON(O)O |
| InChI | InChI=1S/C8H16N2O8/c9-6(5-7(11)12)8(13)17-3-1-16-2-4-18-10(14)15/h6,14-15H,1-5,9H2,(H,11,12) |
| InChIKey | OCMMSHYUNWZTDV-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|