C13H27N3O13S — CID 89081216
2-[2-(dihydroxyamino)oxyethoxy]ethyl [2-amino-3-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonyloxy]propyl]sulfanylformate (PubChem CID 89081216) has the molecular formula C13H27N3O13S and a molecular weight of 465.43 g/mol. Its IUPAC name is 2-[2-(dihydroxyamino)oxyethoxy]ethyl [2-amino-3-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonyloxy]propyl]sulfanylformate.
| Compound Name | 2-[2-(dihydroxyamino)oxyethoxy]ethyl [2-amino-3-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonyloxy]propyl]sulfanylformate |
|---|---|
| PubChem CID | 89081216 |
| Molecular Formula | C13H27N3O13S |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 2-[2-(dihydroxyamino)oxyethoxy]ethyl [2-amino-3-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonyloxy]propyl]sulfanylformate |
| SMILES | NC(COC(=O)OCCOCCON(O)O)CSC(=O)OCCOCCON(O)O |
| InChI | InChI=1S/C13H27N3O13S/c14-11(9-27-12(17)25-5-1-23-3-7-28-15(19)20)10-30-13(18)26-6-2-24-4-8-29-16(21)22/h11,19-22H,1-10,14H2 |
| InChIKey | ZVMRUQBTYMOMKG-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 212.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|