C11H22N2O8 — CID 89255193
2-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylamino]-3-methylpentanoic acid (PubChem CID 89255193) has the molecular formula C11H22N2O8 and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylamino]-3-methylpentanoic acid.
| Compound Name | 2-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 89255193 |
| Molecular Formula | C11H22N2O8 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)OCCOCCON(O)O)C(=O)O |
| InChI | InChI=1S/C11H22N2O8/c1-3-8(2)9(10(14)15)12-11(16)20-6-4-19-5-7-21-13(17)18/h8-9,17-18H,3-7H2,1-2H3,(H,12,16)(H,14,15) |
| InChIKey | NBIRULGBOYVCFP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|