C10H19NO5 — CID 79345601
methyl 2-(2-hydroxyethoxycarbonylamino)-3-methylpentanoate (PubChem CID 79345601) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is methyl 2-(2-hydroxyethoxycarbonylamino)-3-methylpentanoate.
| Compound Name | methyl 2-(2-hydroxyethoxycarbonylamino)-3-methylpentanoate |
|---|---|
| PubChem CID | 79345601 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | methyl 2-(2-hydroxyethoxycarbonylamino)-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)OCCO)C(=O)OC |
| InChI | InChI=1S/C10H19NO5/c1-4-7(2)8(9(13)15-3)11-10(14)16-6-5-12/h7-8,12H,4-6H2,1-3H3,(H,11,14) |
| InChIKey | CIBGAZZCNBHWIY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |