C13H25NO3 — CID 119193969
(2S,3S)-2-(3,4-dimethylpentanoylamino)-3-methylpentanoic acid (PubChem CID 119193969) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (2S,3S)-2-(3,4-dimethylpentanoylamino)-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-(3,4-dimethylpentanoylamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119193969 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (2S,3S)-2-(3,4-dimethylpentanoylamino)-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)CC(C)C(C)C)C(=O)O |
| InChI | InChI=1S/C13H25NO3/c1-6-9(4)12(13(16)17)14-11(15)7-10(5)8(2)3/h8-10,12H,6-7H2,1-5H3,(H,14,15)(H,16,17)/t9-,10?,12-/m0/s1 |
| InChIKey | DLIRZTCOWONWEL-VULFSTHESA-N |
| XLogP | 2.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |