C11H23N2O3+ — CID 44551456
[2-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-2-oxoethyl]-trimethylazanium (PubChem CID 44551456) has the molecular formula C11H23N2O3+ and a molecular weight of 231.32 g/mol. Its IUPAC name is [2-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 44551456 |
| Molecular Formula | C11H23N2O3+ |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | [2-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-2-oxoethyl]-trimethylazanium |
| SMILES | CC[C@H](C)[C@H](NC(=O)C[N+](C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H22N2O3/c1-6-8(2)10(11(15)16)12-9(14)7-13(3,4)5/h8,10H,6-7H2,1-5H3,(H-,12,14,15,16)/p+1/t8-,10-/m0/s1 |
| InChIKey | UMOAPCSYASVHGU-WPRPVWTQSA-O |
| XLogP | 0.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|