C17H34N4O17S — CID 89081425
4-(dihydroxyamino)oxybutyl 2-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylamino]-3-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylsulfanyl]propanoate (PubChem CID 89081425) has the molecular formula C17H34N4O17S and a molecular weight of 598.54 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl 2-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylamino]-3-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylsulfanyl]propanoate.
| Compound Name | 4-(dihydroxyamino)oxybutyl 2-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylamino]-3-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylsulfanyl]propanoate |
|---|---|
| PubChem CID | 89081425 |
| Molecular Formula | C17H34N4O17S |
| Molecular Weight | 598.54 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl 2-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylamino]-3-[2-[2-(dihydroxyamino)oxyethoxy]ethoxycarbonylsulfanyl]propanoate |
| SMILES | O=C(NC(CSC(=O)OCCOCCON(O)O)C(=O)OCCCCON(O)O)OCCOCCON(O)O |
| InChI | InChI=1S/C17H34N4O17S/c22-15(33-3-1-2-4-36-19(25)26)14(18-16(23)34-9-5-31-7-11-37-20(27)28)13-39-17(24)35-10-6-32-8-12-38-21(29)30/h14,25-30H,1-13H2,(H,18,23) |
| InChIKey | YDNGWXQNAWAEOO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 268.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.54 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|