C19H38N6O12 — CID 89081200
5-[[amino-[6-(dihydroxyamino)oxyhexoxycarbonylamino]methylidene]amino]-2-[5-(dihydroxyamino)oxypentoxycarbonylamino]pentanoic acid (PubChem CID 89081200) has the molecular formula C19H38N6O12 and a molecular weight of 542.54 g/mol. Its IUPAC name is 5-[[amino-[6-(dihydroxyamino)oxyhexoxycarbonylamino]methylidene]amino]-2-[5-(dihydroxyamino)oxypentoxycarbonylamino]pentanoic acid.
| Compound Name | 5-[[amino-[6-(dihydroxyamino)oxyhexoxycarbonylamino]methylidene]amino]-2-[5-(dihydroxyamino)oxypentoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 89081200 |
| Molecular Formula | C19H38N6O12 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 5-[[amino-[6-(dihydroxyamino)oxyhexoxycarbonylamino]methylidene]amino]-2-[5-(dihydroxyamino)oxypentoxycarbonylamino]pentanoic acid |
| SMILES | N/C(=N\CCCC(NC(=O)OCCCCCON(O)O)C(=O)O)NC(=O)OCCCCCCON(O)O |
| InChI | InChI=1S/C19H38N6O12/c20-17(23-19(29)35-11-4-1-2-6-13-36-24(30)31)21-10-8-9-15(16(26)27)22-18(28)34-12-5-3-7-14-37-25(32)33/h15,30-33H,1-14H2,(H,22,28)(H,26,27)(H3,20,21,23,29) |
| InChIKey | KZEDIOSEFANDHP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 258.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|