C17H25ClN8O4 — CID 10694424
(2S)-2-[5-(6-chloropurin-9-yl)pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 10694424) has the molecular formula C17H25ClN8O4 and a molecular weight of 440.89 g/mol. Its IUPAC name is (2S)-2-[5-(6-chloropurin-9-yl)pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[5-(6-chloropurin-9-yl)pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 10694424 |
| Molecular Formula | C17H25ClN8O4 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (2S)-2-[5-(6-chloropurin-9-yl)pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)OCCCCCn1cnc2c(Cl)ncnc21)C(=O)O |
| InChI | InChI=1S/C17H25ClN8O4/c18-13-12-14(23-9-22-13)26(10-24-12)7-2-1-3-8-30-17(29)25-11(15(27)28)5-4-6-21-16(19)20/h9-11H,1-8H2,(H,25,29)(H,27,28)(H4,19,20,21)/t11-/m0/s1 |
| InChIKey | PBNSWMVXGZXYPI-NSHDSACASA-N |
| XLogP | 0.88 |
| TPSA | 183.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|