C18H29N9O5 — CID 54559083
5-(diaminomethylideneamino)-2-[2-[2-[6-(dimethylamino)purin-9-yl]ethoxy]ethoxycarbonylamino]pentanoic acid (PubChem CID 54559083) has the molecular formula C18H29N9O5 and a molecular weight of 451.49 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[2-[2-[6-(dimethylamino)purin-9-yl]ethoxy]ethoxycarbonylamino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[2-[2-[6-(dimethylamino)purin-9-yl]ethoxy]ethoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 54559083 |
| Molecular Formula | C18H29N9O5 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[2-[2-[6-(dimethylamino)purin-9-yl]ethoxy]ethoxycarbonylamino]pentanoic acid |
| SMILES | CN(C)c1ncnc2c1ncn2CCOCCOC(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H29N9O5/c1-26(2)14-13-15(23-10-22-14)27(11-24-13)6-7-31-8-9-32-18(30)25-12(16(28)29)4-3-5-21-17(19)20/h10-12H,3-9H2,1-2H3,(H,25,30)(H,28,29)(H4,19,20,21) |
| InChIKey | ZPGIGINJZGRZKV-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 196.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|