C18H28N8O5 — CID 67592658
(2R)-5-(diaminomethylideneamino)-2-[5-(6-methoxypurin-9-yl)pentoxycarbonylamino]pentanoic acid (PubChem CID 67592658) has the molecular formula C18H28N8O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[5-(6-methoxypurin-9-yl)pentoxycarbonylamino]pentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[5-(6-methoxypurin-9-yl)pentoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 67592658 |
| Molecular Formula | C18H28N8O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[5-(6-methoxypurin-9-yl)pentoxycarbonylamino]pentanoic acid |
| SMILES | COc1ncnc2c1ncn2CCCCCOC(=O)N[C@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H28N8O5/c1-30-15-13-14(22-10-23-15)26(11-24-13)8-3-2-4-9-31-18(29)25-12(16(27)28)6-5-7-21-17(19)20/h10-12H,2-9H2,1H3,(H,25,29)(H,27,28)(H4,19,20,21)/t12-/m1/s1 |
| InChIKey | BKDRPGMXCRDBCA-GFCCVEGCSA-N |
| XLogP | 0.24 |
| TPSA | 192.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|