C20H31N9O4 — CID 10504212
(2S)-5-(diaminomethylideneamino)-2-[5-[6-(2-methylaziridin-1-yl)purin-9-yl]pentoxycarbonylamino]pentanoic acid (PubChem CID 10504212) has the molecular formula C20H31N9O4 and a molecular weight of 461.53 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[5-[6-(2-methylaziridin-1-yl)purin-9-yl]pentoxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[5-[6-(2-methylaziridin-1-yl)purin-9-yl]pentoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 10504212 |
| Molecular Formula | C20H31N9O4 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[5-[6-(2-methylaziridin-1-yl)purin-9-yl]pentoxycarbonylamino]pentanoic acid |
| SMILES | CC1CN1c1ncnc2c1ncn2CCCCCOC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H31N9O4/c1-13-10-29(13)17-15-16(24-11-25-17)28(12-26-15)8-3-2-4-9-33-20(32)27-14(18(30)31)6-5-7-23-19(21)22/h11-14H,2-10H2,1H3,(H,27,32)(H,30,31)(H4,21,22,23)/t13?,14-,29?/m0/s1 |
| InChIKey | UXGKRWZBIXBSKP-WEKWXWCPSA-N |
| XLogP | 0.44 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|