C11H22N4O5 — CID 54043745
(2S)-5-(diaminomethylideneamino)-2-(2-ethoxyethoxycarbonylamino)pentanoic acid (PubChem CID 54043745) has the molecular formula C11H22N4O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-(2-ethoxyethoxycarbonylamino)pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-(2-ethoxyethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 54043745 |
| Molecular Formula | C11H22N4O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-(2-ethoxyethoxycarbonylamino)pentanoic acid |
| SMILES | CCOCCOC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C11H22N4O5/c1-2-19-6-7-20-11(18)15-8(9(16)17)4-3-5-14-10(12)13/h8H,2-7H2,1H3,(H,15,18)(H,16,17)(H4,12,13,14)/t8-/m0/s1 |
| InChIKey | LODCYPNLYLHKLP-QMMMGPOBSA-N |
| XLogP | -0.74 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|